CAS 957066-05-6 appears in our catalog under these names: 4-Acetyl-2-Bromo-1-morpholinobenzene, 96%, 3’–Bromo–4’–morpholinoacetophenone, 3'-Bromo-4'-morpholinoacetophenone, >97%, >97%, 1-(3-Bromo-4-morpholinophenyl)ethanone. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 100g, 25g, 5g.
1-(3-bromo-4-morpholin-4-ylphenyl)ethanone (CAS 957066-05-6) is a chemical compound with the molecular formula C12H14BrNO2 and a molecular weight of 284.15 g/mol. IUPAC name: 1-(3-bromo-4-morpholin-4-ylphenyl)ethanone. InChIKey: FFGSRLSYOANMJK-UHFFFAOYSA-N.
| Molecular formula | C12H14BrNO2 |
|---|---|
| Molecular weight | 284.15 g/mol |
| IUPAC name | 1-(3-bromo-4-morpholin-4-ylphenyl)ethanone |
| InChIKey | FFGSRLSYOANMJK-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=C(C=C1)N2CCOCC2)Br |
Computed by PubChem (NCBI)