CAS 1262011-20-0 appears in our catalog under these names: N-Cyclopropyl 4-bromo-2-ethoxybenzamide, 98%, 4-Bromo-N-cyclopropyl-2-ethoxybenzamide, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 25g, 5g.
4-bromo-N-cyclopropyl-2-ethoxybenzamide (CAS 1262011-20-0) is a chemical compound with the molecular formula C12H14BrNO2 and a molecular weight of 284.15 g/mol. IUPAC name: 4-bromo-N-cyclopropyl-2-ethoxybenzamide. InChIKey: RIVUMXSITHSCTI-UHFFFAOYSA-N.
| Molecular formula | C12H14BrNO2 |
|---|---|
| Molecular weight | 284.15 g/mol |
| IUPAC name | 4-bromo-N-cyclopropyl-2-ethoxybenzamide |
| InChIKey | RIVUMXSITHSCTI-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=CC(=C1)Br)C(=O)NC2CC2 |
Computed by PubChem (NCBI)