cas: 1889-71-0 — see every product listed under this CAS number, including other names
Benzyl 4-chlorophenyl ketone 95% (CAS 1889-71-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A523558-1g |
| cas | 1889-71-0 |
| size | 1g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 131.19 Pln | |
| Ambeed | 10g | 175.69 Pln | |
| Ambeed | 25g | 203.50 Pln | |
| Ambeed | 100g | 587.31 Pln | |
| Ambeed | 500g | 2656.56 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A523558 |
1-(4-chlorophenyl)-2-phenylethanone (CAS 1889-71-0) is a chemical compound with the molecular formula C14H11ClO and a molecular weight of 230.69 g/mol. IUPAC name: 1-(4-chlorophenyl)-2-phenylethanone. InChIKey: DXVALSKCLLBZEB-UHFFFAOYSA-N.
| Molecular formula | C14H11ClO |
|---|---|
| Molecular weight | 230.69 g/mol |
| IUPAC name | 1-(4-chlorophenyl)-2-phenylethanone |
| InChIKey | DXVALSKCLLBZEB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC(=O)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)