cas: 1355171-29-7 — see every product listed under this CAS number, including other names
Benzyl 6,7-dihydro-2H-pyrazolo[4,3-c]pyridine-5(4H)-carboxylate, 97% (CAS 1355171-29-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F335682-100MG |
| cas | 1355171-29-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 378.01 Pln | |
| Fluorochem | 250mg | 596.68 Pln | |
| Fluorochem | 500mg | 1080.89 Pln | |
| Fluorochem | 1g | 1450.55 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Benzyl 1,4,6,7-tetrahydropyrazolo[4,5-c]pyridine-5-carboxylate (CAS 1355171-29-7) is a chemical compound with the molecular formula C14H15N3O2 and a molecular weight of 257.29 g/mol. IUPAC name: benzyl 1,4,6,7-tetrahydropyrazolo[4,5-c]pyridine-5-carboxylate. InChIKey: LQYVAXIQTIQDEK-UHFFFAOYSA-N.
| Molecular formula | C14H15N3O2 |
|---|---|
| Molecular weight | 257.29 g/mol |
| IUPAC name | benzyl 1,4,6,7-tetrahydropyrazolo[4,5-c]pyridine-5-carboxylate |
| InChIKey | LQYVAXIQTIQDEK-UHFFFAOYSA-N |
| SMILES | C1CN(CC2=C1NN=C2)C(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)