CAS 284462-74-4 appears in our catalog under these names: 4-(4-Amino-3-methylphenoxy)-N-methylpyridine-2-carboxamide, 4-(4-Amino-3-methylphenoxy)-n-methylpyridine-2-carboxamide, 95%. Offered by: Biosynth, Combi-blocks, AmBeed. Available pack sizes: 0,5g, 50mg, 5g, 250mg, 1g.
4-(4-amino-3-methylphenoxy)-N-methylpyridine-2-carboxamide (CAS 284462-74-4) is a chemical compound with the molecular formula C14H15N3O2 and a molecular weight of 257.29 g/mol. IUPAC name: 4-(4-amino-3-methylphenoxy)-N-methylpyridine-2-carboxamide. InChIKey: SQSSBCSNKRMGDM-UHFFFAOYSA-N.
| Molecular formula | C14H15N3O2 |
|---|---|
| Molecular weight | 257.29 g/mol |
| IUPAC name | 4-(4-amino-3-methylphenoxy)-N-methylpyridine-2-carboxamide |
| InChIKey | SQSSBCSNKRMGDM-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)OC2=CC(=NC=C2)C(=O)NC)N |
Computed by PubChem (NCBI)