cas: 70782-12-6 — see every product listed under this CAS number, including other names
Benzyl bis(2-hydroxyethyl)carbamate 95% (CAS 70782-12-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A190979-250mg |
| cas | 70782-12-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 225.75 Pln | |
| Ambeed | 5g | 698.56 Pln | |
| Ambeed | 25g | 1905.62 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A190979 |
Benzyl N,N-bis(2-hydroxyethyl)carbamate (CAS 70782-12-6) is a chemical compound with the molecular formula C12H17NO4 and a molecular weight of 239.27 g/mol. IUPAC name: benzyl N,N-bis(2-hydroxyethyl)carbamate. InChIKey: QCMILQCFDHNPGB-UHFFFAOYSA-N.
| Molecular formula | C12H17NO4 |
|---|---|
| Molecular weight | 239.27 g/mol |
| IUPAC name | benzyl N,N-bis(2-hydroxyethyl)carbamate |
| InChIKey | QCMILQCFDHNPGB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)N(CCO)CCO |
Computed by PubChem (NCBI)