cas: 7662-76-2 — see every product listed under this CAS number, including other names
Benzylamino-acetic acid tert-butyl ester, 97% (CAS 7662-76-2) is a chemical reagent available from Chemat. Available pack sizes: 500mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F317405-500MG |
| cas | 7662-76-2 |
| size | 500mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 500mg | 664.37 Pln | |
| Fluorochem | 1g | 971.55 Pln | |
| Fluorochem | 5g | 3376.95 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl 2-(benzylamino)acetate (CAS 7662-76-2) is a chemical compound with the molecular formula C13H19NO2 and a molecular weight of 221.29 g/mol. IUPAC name: tert-butyl 2-(benzylamino)acetate. InChIKey: UURAHTSUPDIUNL-UHFFFAOYSA-N.
| Molecular formula | C13H19NO2 |
|---|---|
| Molecular weight | 221.29 g/mol |
| IUPAC name | tert-butyl 2-(benzylamino)acetate |
| InChIKey | UURAHTSUPDIUNL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CNCC1=CC=CC=C1 |
Computed by PubChem (NCBI)