cas: 25316-59-0 — see every product listed under this CAS number, including other names
Benzyltributylammonium Bromide, >98.0%(T) (CAS 25316-59-0) is a chemical reagent available from Chemat. Available pack sizes: 25g, 500g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | B1217-25G |
| cas | 25316-59-0 |
| size | 25g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 25g | 123.26 Pln | |
| TCI | 500g | 954.28 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(T) |
Benzyl(tributyl)azanium (CAS 25316-59-0) is a chemical compound with the molecular formula C19H34N+ and a molecular weight of 276.5 g/mol. IUPAC name: benzyl(tributyl)azanium. InChIKey: QSRFYFHZPSGRQX-UHFFFAOYSA-N.
| Molecular formula | C19H34N+ |
|---|---|
| Molecular weight | 276.5 g/mol |
| IUPAC name | benzyl(tributyl)azanium |
| InChIKey | QSRFYFHZPSGRQX-UHFFFAOYSA-N |
| SMILES | CCCC[N+](CCCC)(CCCC)CC1=CC=CC=C1 |
Computed by PubChem (NCBI)