cas: 25316-59-0 — see every product listed under this CAS number, including other names
N-Benzyl-N,N-dibutylbutan-1-aminium bromide, 95% (CAS 25316-59-0) is a chemical reagent available from Chemat. Available pack sizes: 100g, 500g, 1kg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F243004-100G |
| cas | 25316-59-0 |
| size | 100g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100g | 107.27 Pln | |
| Fluorochem | 500g | 247.85 Pln | |
| Fluorochem | 1kg | 372.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
Benzyl(tributyl)azanium (CAS 25316-59-0) is a chemical compound with the molecular formula C19H34N+ and a molecular weight of 276.5 g/mol. IUPAC name: benzyl(tributyl)azanium. InChIKey: QSRFYFHZPSGRQX-UHFFFAOYSA-N.
| Molecular formula | C19H34N+ |
|---|---|
| Molecular weight | 276.5 g/mol |
| IUPAC name | benzyl(tributyl)azanium |
| InChIKey | QSRFYFHZPSGRQX-UHFFFAOYSA-N |
| SMILES | CCCC[N+](CCCC)(CCCC)CC1=CC=CC=C1 |
Computed by PubChem (NCBI)