cas: 25316-59-0 — see every product listed under this CAS number, including other names
Tributylbenzylammonium bromide 98% (CAS 25316-59-0) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A148994-25g |
| cas | 25316-59-0 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 25g | 203.50 Pln | |
| Ambeed | 100g | 331.44 Pln | |
| Ambeed | 500g | 492.75 Pln | |
| Ambeed | 1000g | 798.69 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A148994 |
Benzyl(tributyl)azanium (CAS 25316-59-0) is a chemical compound with the molecular formula C19H34N+ and a molecular weight of 276.5 g/mol. IUPAC name: benzyl(tributyl)azanium. InChIKey: QSRFYFHZPSGRQX-UHFFFAOYSA-N.
| Molecular formula | C19H34N+ |
|---|---|
| Molecular weight | 276.5 g/mol |
| IUPAC name | benzyl(tributyl)azanium |
| InChIKey | QSRFYFHZPSGRQX-UHFFFAOYSA-N |
| SMILES | CCCC[N+](CCCC)(CCCC)CC1=CC=CC=C1 |
Computed by PubChem (NCBI)