cas: 25316-59-0 — see every product listed under this CAS number, including other names
Tributylbenzylammonium (bromide), 98.0% (CAS 25316-59-0) is a chemical reagent available from Chemat. Available pack sizes: 100 g, 500 g, 50 g, 25 g, 1 kg. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W011122-100 g |
| cas | 25316-59-0 |
| size | 100 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 100 g | 384.71 Pln | |
| MedChemExpress | 500 g | 649.42 Pln | |
| MedChemExpress | 50 g | 310.40 Pln | |
| MedChemExpress | 25 g | 240.74 Pln | |
| MedChemExpress | 1 kg | 909.48 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 98.0% |
Benzyl(tributyl)azanium (CAS 25316-59-0) is a chemical compound with the molecular formula C19H34N+ and a molecular weight of 276.5 g/mol. IUPAC name: benzyl(tributyl)azanium. InChIKey: QSRFYFHZPSGRQX-UHFFFAOYSA-N.
| Molecular formula | C19H34N+ |
|---|---|
| Molecular weight | 276.5 g/mol |
| IUPAC name | benzyl(tributyl)azanium |
| InChIKey | QSRFYFHZPSGRQX-UHFFFAOYSA-N |
| SMILES | CCCC[N+](CCCC)(CCCC)CC1=CC=CC=C1 |
Computed by PubChem (NCBI)