cas: 1513-87-7 — see every product listed under this CAS number, including other names
Bis(2,2,2-trifluoroethyl) Carbonate, >98.0%(GC) (CAS 1513-87-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | B4703-5G |
| cas | 1513-87-7 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 409.95 Pln | |
| TCI | 25g | 1147.54 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC) |
Bis(2,2,2-trifluoroethyl) carbonate (CAS 1513-87-7) is a chemical compound with the molecular formula C5H4F6O3 and a molecular weight of 226.07 g/mol. IUPAC name: bis(2,2,2-trifluoroethyl) carbonate. InChIKey: WLLOZRDOFANZMZ-UHFFFAOYSA-N.
| Molecular formula | C5H4F6O3 |
|---|---|
| Molecular weight | 226.07 g/mol |
| IUPAC name | bis(2,2,2-trifluoroethyl) carbonate |
| InChIKey | WLLOZRDOFANZMZ-UHFFFAOYSA-N |
| SMILES | C(C(F)(F)F)OC(=O)OCC(F)(F)F |
Computed by PubChem (NCBI)