CAS 1513-87-7 appears in our catalog under these names: Bis(2,2,2-trifluoroethyl) carbonate, 97%, bis(2,2,2-Trifluoroethyl)carbonate, >95% (GC), Bis(2,2,2-trifluoroethyl) Carbonate, >98.0%(GC), Bis(2,2,2-trifluoroethyl) carbonate 98%, BIS(2,2,2-TRIFLUOROETHYL) CARBONATE. Offered by: Combi-blocks, TRC, TCI, Ambeed, Sigma-Aldrich. Available pack sizes: 1g, 25g, 100g, 5g, 10g, 500mg, 50G, 2.5g.
Bis(2,2,2-trifluoroethyl) carbonate (CAS 1513-87-7) is a chemical compound with the molecular formula C5H4F6O3 and a molecular weight of 226.07 g/mol. IUPAC name: bis(2,2,2-trifluoroethyl) carbonate. InChIKey: WLLOZRDOFANZMZ-UHFFFAOYSA-N.
| Molecular formula | C5H4F6O3 |
|---|---|
| Molecular weight | 226.07 g/mol |
| IUPAC name | bis(2,2,2-trifluoroethyl) carbonate |
| InChIKey | WLLOZRDOFANZMZ-UHFFFAOYSA-N |
| SMILES | C(C(F)(F)F)OC(=O)OCC(F)(F)F |
Computed by PubChem (NCBI)