cas: 1513-87-7 — see every product listed under this CAS number, including other names
Bis(2,2,2-trifluoroethyl) Carbonate, 98%, 98% (CAS 1513-87-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112N0H-1g |
| cas | 1513-87-7 |
| size | 1g |
| availability | 500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 126.80 Pln | |
| Chemat | 25g | 333.20 Pln | |
| Chemat | 100g | 1163.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Bis(2,2,2-trifluoroethyl) carbonate (CAS 1513-87-7) is a chemical compound with the molecular formula C5H4F6O3 and a molecular weight of 226.07 g/mol. IUPAC name: bis(2,2,2-trifluoroethyl) carbonate. InChIKey: WLLOZRDOFANZMZ-UHFFFAOYSA-N.
| Molecular formula | C5H4F6O3 |
|---|---|
| Molecular weight | 226.07 g/mol |
| IUPAC name | bis(2,2,2-trifluoroethyl) carbonate |
| InChIKey | WLLOZRDOFANZMZ-UHFFFAOYSA-N |
| SMILES | C(C(F)(F)F)OC(=O)OCC(F)(F)F |
Computed by PubChem (NCBI)