cas: 1513-87-7 — see every product listed under this CAS number, including other names
Bis(2,2,2-trifluoroethyl) carbonate 98% (CAS 1513-87-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A427370-1g |
| cas | 1513-87-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 197.94 Pln | |
| Ambeed | 25g | 620.69 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A427370 |
Bis(2,2,2-trifluoroethyl) carbonate (CAS 1513-87-7) is a chemical compound with the molecular formula C5H4F6O3 and a molecular weight of 226.07 g/mol. IUPAC name: bis(2,2,2-trifluoroethyl) carbonate. InChIKey: WLLOZRDOFANZMZ-UHFFFAOYSA-N.
| Molecular formula | C5H4F6O3 |
|---|---|
| Molecular weight | 226.07 g/mol |
| IUPAC name | bis(2,2,2-trifluoroethyl) carbonate |
| InChIKey | WLLOZRDOFANZMZ-UHFFFAOYSA-N |
| SMILES | C(C(F)(F)F)OC(=O)OCC(F)(F)F |
Computed by PubChem (NCBI)