cas: 5293-97-0 — see every product listed under this CAS number, including other names
Bis(2-chlorophenyl)methanone (CAS 5293-97-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114FAI-1g |
| cas | 5293-97-0 |
| size | 1g |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 525.20 Pln | |
| Chemat | 5g | 2042.00 Pln |
| delivery time | 3 weeks |
|---|
Bis(2-chlorophenyl)methanone (CAS 5293-97-0) is a chemical compound with the molecular formula C13H8Cl2O and a molecular weight of 251.10 g/mol. IUPAC name: bis(2-chlorophenyl)methanone. InChIKey: DRDRZHJTTDSOPK-UHFFFAOYSA-N.
| Molecular formula | C13H8Cl2O |
|---|---|
| Molecular weight | 251.10 g/mol |
| IUPAC name | bis(2-chlorophenyl)methanone |
| InChIKey | DRDRZHJTTDSOPK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)C2=CC=CC=C2Cl)Cl |
Computed by PubChem (NCBI)