cas: 84-73-1 — see every product listed under this CAS number, including other names
Bis(2-hydroxyethyl) phthalate, 97%, 97% (CAS 84-73-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11GA10-100mg |
| cas | 84-73-1 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 203.60 Pln | |
| Chemat | 250mg | 400.40 Pln | |
| Chemat | 1g | 1389.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Bis(2-hydroxyethyl) benzene-1,2-dicarboxylate (CAS 84-73-1) is a chemical compound with the molecular formula C12H14O6 and a molecular weight of 254.24 g/mol. IUPAC name: bis(2-hydroxyethyl) benzene-1,2-dicarboxylate. InChIKey: CAKVXHUYTFYBPK-UHFFFAOYSA-N.
| Molecular formula | C12H14O6 |
|---|---|
| Molecular weight | 254.24 g/mol |
| IUPAC name | bis(2-hydroxyethyl) benzene-1,2-dicarboxylate |
| InChIKey | CAKVXHUYTFYBPK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)OCCO)C(=O)OCCO |
Computed by PubChem (NCBI)