CAS 38175-27-8 appears in our catalog under these names: 2-(3,4-Dimethoxyphenyl)succinic acid, 95%, 2-(3,4-Dimethoxyphenyl)succinic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
2-(3,4-dimethoxyphenyl)butanedioic acid (CAS 38175-27-8) is a chemical compound with the molecular formula C12H14O6 and a molecular weight of 254.24 g/mol. IUPAC name: 2-(3,4-dimethoxyphenyl)butanedioic acid. InChIKey: GYTBTYAZXWMNGB-UHFFFAOYSA-N.
| Molecular formula | C12H14O6 |
|---|---|
| Molecular weight | 254.24 g/mol |
| IUPAC name | 2-(3,4-dimethoxyphenyl)butanedioic acid |
| InChIKey | GYTBTYAZXWMNGB-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C(CC(=O)O)C(=O)O)OC |
Computed by PubChem (NCBI)