Products 812642-68-5

CAS 812642-68-5 is the registry number for 2-(4-Formyl-2,6-dimethoxyphenoxy)propanoic acid, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

2-(4-formyl-2,6-dimethoxyphenoxy)propanoic acid (CAS 812642-68-5) is a chemical compound with the molecular formula C12H14O6 and a molecular weight of 254.24 g/mol. IUPAC name: 2-(4-formyl-2,6-dimethoxyphenoxy)propanoic acid. InChIKey: ZZTPVGFRGWPXEF-UHFFFAOYSA-N.

Identity
Molecular formulaC12H14O6
Molecular weight254.24 g/mol
IUPAC name2-(4-formyl-2,6-dimethoxyphenoxy)propanoic acid
InChIKeyZZTPVGFRGWPXEF-UHFFFAOYSA-N
SMILESCC(C(=O)O)OC1=C(C=C(C=C1OC)C=O)OC

Computed by PubChem (NCBI)