CAS 105338-31-6 is the registry number for 2-Oxo-3-(2,4,6-trimethoxyphenyl)propanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-oxo-3-(2,4,6-trimethoxyphenyl)propanoic acid (CAS 105338-31-6) is a chemical compound with the molecular formula C12H14O6 and a molecular weight of 254.24 g/mol. IUPAC name: 2-oxo-3-(2,4,6-trimethoxyphenyl)propanoic acid. InChIKey: SBAONPZUSQKTMR-UHFFFAOYSA-N.
| Molecular formula | C12H14O6 |
|---|---|
| Molecular weight | 254.24 g/mol |
| IUPAC name | 2-oxo-3-(2,4,6-trimethoxyphenyl)propanoic acid |
| InChIKey | SBAONPZUSQKTMR-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C(=C1)OC)CC(=O)C(=O)O)OC |
Computed by PubChem (NCBI)