Bis(4-nitrophenyl)amine, 96%
cas: 1821-27-8 — see every product listed under this CAS number, including other names
Bis(4-nitrophenyl)amine, 96% (CAS 1821-27-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 100mg, 15g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A229887-250mg |
| cas | 1821-27-8 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 170.12 Pln | |
| Ambeed | 1g | 192.38 Pln | |
| Ambeed | 5g | 325.88 Pln | |
| Ambeed | 10g | 570.62 Pln | |
| Ambeed | 25g | 1082.38 Pln | |
| Ambeed | 100g | 3307.38 Pln | |
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 93.20 Pln | |
| Chemat | 1g | 102.80 Pln | |
| Chemat | 5g | 213.20 Pln | |
| Chemat | 10g | 347.60 Pln | |
| Chemat | 15g | 486.80 Pln | |
| Chemat | 25g | 635.60 Pln | |
| BLDpharm | 100mg | 125.54 Pln | |
| BLDpharm | 250mg | 158.86 Pln | |
| BLDpharm | 1g | 192.18 Pln | |
| BLDpharm | 5g | 342.13 Pln | |
| BLDpharm | 10g | 614.25 Pln | |
| BLDpharm | 25g | 1147.40 Pln |
properties
| purity | 96% |
|---|---|
| delivery time | 1-2 weeks |
4-nitro-N-(4-nitrophenyl)aniline (CAS 1821-27-8) is a chemical compound with the molecular formula C12H9N3O4 and a molecular weight of 259.22 g/mol. IUPAC name: 4-nitro-N-(4-nitrophenyl)aniline. InChIKey: MTWHRQTUBOTQTE-UHFFFAOYSA-N.
| Molecular formula | C12H9N3O4 |
|---|---|
| Molecular weight | 259.22 g/mol |
| IUPAC name | 4-nitro-N-(4-nitrophenyl)aniline |
| InChIKey | MTWHRQTUBOTQTE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1NC2=CC=C(C=C2)[N+](=O)[O-])[N+](=O)[O-] |
Computed by PubChem (NCBI)
Synonyms:
4-Nitro-N-(4-nitrophenyl)aniline, 4,4'-Dinitrodiphenylamine, Bis(4-nitrophenyl)amine, Bis-(4-nitrophenyl)amine, Bis(p-nitrophenyl)amine, 4-Nitro-N-(4-nitrophenyl)aniline #, 4-Nitro-N-(4-nitrophenyl)benzenamine, Benzenamine,4-nitro-N-(4-nitrophenyl)-, Diphenylamine, 4,4'-dinitro-, 4,4''-Dinitrodiphenylamine
