CAS 612-36-2 is the registry number for 2-Nitro-N-(4-nitrophenyl)aniline 95%. Offered by: Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g.
2-nitro-N-(4-nitrophenyl)aniline (CAS 612-36-2) is a chemical compound with the molecular formula C12H9N3O4 and a molecular weight of 259.22 g/mol. IUPAC name: 2-nitro-N-(4-nitrophenyl)aniline. InChIKey: TXJIDOLTOGSNPD-UHFFFAOYSA-N.
| Molecular formula | C12H9N3O4 |
|---|---|
| Molecular weight | 259.22 g/mol |
| IUPAC name | 2-nitro-N-(4-nitrophenyl)aniline |
| InChIKey | TXJIDOLTOGSNPD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)NC2=CC=C(C=C2)[N+](=O)[O-])[N+](=O)[O-] |
Computed by PubChem (NCBI)