CAS 51787-75-8 appears in our catalog under these names: 4,4′-Dinitro-2-biphenylamine 98%, 4,4'-Dinitro-[1,1'-Biphenyl]-2-Amine, 98%, 98%, 4,4'-Dinitro-[1,1'-biphenyl]-2-amine, 98%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100g, 1g, 5g, 10g, 25g, 250mg.
5-nitro-2-(4-nitrophenyl)aniline (CAS 51787-75-8) is a chemical compound with the molecular formula C12H9N3O4 and a molecular weight of 259.22 g/mol. IUPAC name: 5-nitro-2-(4-nitrophenyl)aniline. InChIKey: FRZPYFUNNLIMEC-UHFFFAOYSA-N.
| Molecular formula | C12H9N3O4 |
|---|---|
| Molecular weight | 259.22 g/mol |
| IUPAC name | 5-nitro-2-(4-nitrophenyl)aniline |
| InChIKey | FRZPYFUNNLIMEC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=C(C=C(C=C2)[N+](=O)[O-])N)[N+](=O)[O-] |
Computed by PubChem (NCBI)