Bis-(3,4-dimethylphenyl)amine, 97%
cas: 55389-75-8 — see every product listed under this CAS number, including other names
Bis-(3,4-dimethylphenyl)amine, 97% (CAS 55389-75-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg, 10g, 25g. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A391025-250mg |
| cas | 55389-75-8 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 359.25 Pln | |
| Ambeed | 1g | 971.12 Pln | |
| Ambeed | 5g | 2834.56 Pln | |
| BLDpharm | 100mg | 242.16 Pln | |
| BLDpharm | 250mg | 386.56 Pln | |
| BLDpharm | 1g | 1041.88 Pln | |
| BLDpharm | 5g | 3046.73 Pln | |
| Chemat | 100mg | 160.40 Pln | |
| Chemat | 250mg | 227.60 Pln | |
| Chemat | 1g | 318.80 Pln | |
| Chemat | 5g | 1278.80 Pln | |
| Chemat | 10g | 2128.40 Pln | |
| Chemat | 25g | 4494.80 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
N-(3,4-dimethylphenyl)-3,4-dimethylaniline (CAS 55389-75-8) is a chemical compound with the molecular formula C16H19N and a molecular weight of 225.33 g/mol. IUPAC name: N-(3,4-dimethylphenyl)-3,4-dimethylaniline. InChIKey: IMQQPEKHINRTCE-UHFFFAOYSA-N.
| Molecular formula | C16H19N |
|---|---|
| Molecular weight | 225.33 g/mol |
| IUPAC name | N-(3,4-dimethylphenyl)-3,4-dimethylaniline |
| InChIKey | IMQQPEKHINRTCE-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)NC2=CC(=C(C=C2)C)C)C |
Computed by PubChem (NCBI)
Synonyms:
bis(3,4-dimethylphenyl)amine, Bis-(3,4-dimethyl-phenyl)-amine, Bis-(3,4-dimethylphenyl)amine, N-(3,4-Dimethylphenyl)-3,4-dimethylaniline, N-(3,4-dimethylphenyl)-3,4-dimethyl-aniline, Benzenamine, N-(3,4-dimethylphenyl)-3,4-dimethyl-, 3,3',4,4'-tetramethyldiphenylamine, 3,3',4,4'-tetram, N-(3,4-Dimethylphenyl)-3,4-dimethylaniline #, Aniline, N-(3,4-dimethylphenyl)-3,4-dimethyl-