CAS 5728-71-2 appears in our catalog under these names: 4-(4-tert-Butylphenyl)aniline, 95%, 4'-(tert-Butyl)-[1,1'-biphenyl]-4-amine 95%, 4'-(tert-Butyl)-[1,1'-biphenyl]-4-amine, 95%, 95%, 4'-tert-Butyl[1,1'-biphenyl]-4-amine, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 10g, 25g, 100g.
4-(4-tert-butylphenyl)aniline (CAS 5728-71-2) is a chemical compound with the molecular formula C16H19N and a molecular weight of 225.33 g/mol. IUPAC name: 4-(4-tert-butylphenyl)aniline. InChIKey: QFFMMXMPHCYRSN-UHFFFAOYSA-N.
| Molecular formula | C16H19N |
|---|---|
| Molecular weight | 225.33 g/mol |
| IUPAC name | 4-(4-tert-butylphenyl)aniline |
| InChIKey | QFFMMXMPHCYRSN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)C2=CC=C(C=C2)N |
Computed by PubChem (NCBI)