cas: 269396-71-6 — see every product listed under this CAS number, including other names
Boc-(R)-3-Amino-4-(4-iodo-phenyl)-butyric acid, 95%, 95% (CAS 269396-71-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BCVT-100mg |
| cas | 269396-71-6 |
| size | 100mg |
| availability | 16g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 107.60 Pln | |
| Chemat | 250mg | 146.00 Pln | |
| Chemat | 1g | 256.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(3R)-4-(4-iodophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (CAS 269396-71-6) is a chemical compound with the molecular formula C15H20INO4 and a molecular weight of 405.23 g/mol. IUPAC name: (3R)-4-(4-iodophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid. InChIKey: QEKSTALXWONXOD-GFCCVEGCSA-N.
| Molecular formula | C15H20INO4 |
|---|---|
| Molecular weight | 405.23 g/mol |
| IUPAC name | (3R)-4-(4-iodophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| InChIKey | QEKSTALXWONXOD-GFCCVEGCSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC1=CC=C(C=C1)I)CC(=O)O |
Computed by PubChem (NCBI)