CAS 500770-86-5 appears in our catalog under these names: (R)-3-((tert-Butoxycarbonyl)amino)-3-(o-tolyl)propanoic acid, 95%, 95%, (R)-Boc-2-methyl-β-Phe-OH. Offered by: Chemat, MedChemExpress. Available pack sizes: 100mg, 250mg, 1g, Get quote.
(3R)-3-(2-methylphenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 500770-86-5) is a chemical compound with the molecular formula C15H21NO4 and a molecular weight of 279.33 g/mol. IUPAC name: (3R)-3-(2-methylphenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: WWDMSBGBNGEQDH-GFCCVEGCSA-N.
| Molecular formula | C15H21NO4 |
|---|---|
| Molecular weight | 279.33 g/mol |
| IUPAC name | (3R)-3-(2-methylphenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | WWDMSBGBNGEQDH-GFCCVEGCSA-N |
| SMILES | CC1=CC=CC=C1[C@@H](CC(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)