cas: 102195-80-2 — see every product listed under this CAS number, including other names
Boc-4-Oxo-Pro-OMe 97% (CAS 102195-80-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A228577-250mg |
| cas | 102195-80-2 |
| size | 250mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 120.06 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 147.88 Pln | |
| Ambeed | 10g | 164.56 Pln | |
| Ambeed | 25g | 186.81 Pln | |
| Ambeed | 100g | 370.38 Pln | |
| Ambeed | 500g | 1555.19 Pln | |
| Ambeed | 1000g | 2600.94 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A228577 |
1-O-tert-butyl 2-O-methyl (2S)-4-oxopyrrolidine-1,2-dicarboxylate (CAS 102195-80-2) is a chemical compound with the molecular formula C11H17NO5 and a molecular weight of 243.26 g/mol. IUPAC name: 1-O-tert-butyl 2-O-methyl (2S)-4-oxopyrrolidine-1,2-dicarboxylate. InChIKey: UPBHYYJZVWZCOZ-QMMMGPOBSA-N.
| Molecular formula | C11H17NO5 |
|---|---|
| Molecular weight | 243.26 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-methyl (2S)-4-oxopyrrolidine-1,2-dicarboxylate |
| InChIKey | UPBHYYJZVWZCOZ-QMMMGPOBSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(=O)C[C@H]1C(=O)OC |
Computed by PubChem (NCBI)