cas: 77302-72-8 — see every product listed under this CAS number, including other names
Boc-Aad-OH 95% (CAS 77302-72-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A912649-100mg |
| cas | 77302-72-8 |
| size | 100mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 142.31 Pln | |
| Ambeed | 250mg | 203.50 Pln | |
| Ambeed | 1g | 242.44 Pln | |
| Ambeed | 5g | 915.50 Pln | |
| Ambeed | 10g | 1516.25 Pln | |
| Ambeed | 25g | 2956.94 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A912649 |
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanedioic acid (CAS 77302-72-8) is a chemical compound with the molecular formula C11H19NO6 and a molecular weight of 261.27 g/mol. IUPAC name: (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanedioic acid. InChIKey: QDTDLMJRZPSKDM-ZETCQYMHSA-N.
| Molecular formula | C11H19NO6 |
|---|---|
| Molecular weight | 261.27 g/mol |
| IUPAC name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanedioic acid |
| InChIKey | QDTDLMJRZPSKDM-ZETCQYMHSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCCC(=O)O)C(=O)O |
Computed by PubChem (NCBI)