CAS 77302-72-8 appears in our catalog under these names: (S)–2–((tert–Butoxycarbonyl)amino)hexanedioic acid, Boc-Aad-OH 95%, (S)-2-((tert-Butoxycarbonyl)amino)hexanedioic acid, 95%, 95%, (S)-2-((tert-Butoxycarbonyl)amino)hexanedioic acid, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg, 10g, 25g.
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanedioic acid (CAS 77302-72-8) is a chemical compound with the molecular formula C11H19NO6 and a molecular weight of 261.27 g/mol. IUPAC name: (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanedioic acid. InChIKey: QDTDLMJRZPSKDM-ZETCQYMHSA-N.
| Molecular formula | C11H19NO6 |
|---|---|
| Molecular weight | 261.27 g/mol |
| IUPAC name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanedioic acid |
| InChIKey | QDTDLMJRZPSKDM-ZETCQYMHSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCCC(=O)O)C(=O)O |
Computed by PubChem (NCBI)