cas: 19746-37-3 — see every product listed under this CAS number, including other names
Boc-Cys(Acm)-OH, 96% (CAS 19746-37-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 500g, 1g, 10g, 50g, 250g. Offered by: Fluorochem, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | M03273-5G |
| cas | 19746-37-3 |
| size | 5g |
| availability | In Stock UK |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 102.07 Pln | |
| Fluorochem | 25g | 211.40 Pln | |
| Fluorochem | 100g | 664.37 Pln | |
| Fluorochem | 500g | 3012.50 Pln | |
| Chemat | 1g | 83.60 Pln | |
| Chemat | 5g | 88.40 Pln | |
| Chemat | 10g | 117.20 Pln | |
| Chemat | 25g | 179.60 Pln | |
| Chemat | 50g | 299.60 Pln | |
| Chemat | 100g | 539.60 Pln | |
| Chemat | 250g | 1259.60 Pln | |
| Chemat | 500g | 2524.80 Pln |
| purity | 96% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 1-2 weeks |
| category | Odczynniki chemiczne |
(2R)-3-(acetamidomethylsulfanyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 19746-37-3) is a chemical compound with the molecular formula C11H20N2O5S and a molecular weight of 292.35 g/mol. IUPAC name: (2R)-3-(acetamidomethylsulfanyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: HLCTYBOTPCIHTG-QMMMGPOBSA-N.
| Molecular formula | C11H20N2O5S |
|---|---|
| Molecular weight | 292.35 g/mol |
| IUPAC name | (2R)-3-(acetamidomethylsulfanyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | HLCTYBOTPCIHTG-QMMMGPOBSA-N |
| SMILES | CC(=O)NCSC[C@@H](C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)