cas: 16947-80-1 — see every product listed under this CAS number, including other names
Boc-Cys(Me)-OH, 96% (CAS 16947-80-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A526864-250mg |
| cas | 16947-80-1 |
| size | 250mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 203.50 Pln | |
| Ambeed | 5g | 437.12 Pln | |
| Ambeed | 25g | 1254.81 Pln | |
| BLDpharm | 250mg | 153.30 Pln | |
| BLDpharm | 1g | 214.39 Pln | |
| BLDpharm | 5g | 464.31 Pln | |
| BLDpharm | 25g | 1347.33 Pln |
| purity | 96% |
|---|---|
| delivery time | 1-2 weeks |
(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-methylsulfanylpropanoic acid (CAS 16947-80-1) is a chemical compound with the molecular formula C9H17NO4S and a molecular weight of 235.30 g/mol. IUPAC name: (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-methylsulfanylpropanoic acid. InChIKey: WFDQTEFRLDDJAM-LURJTMIESA-N.
| Molecular formula | C9H17NO4S |
|---|---|
| Molecular weight | 235.30 g/mol |
| IUPAC name | (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-methylsulfanylpropanoic acid |
| InChIKey | WFDQTEFRLDDJAM-LURJTMIESA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CSC)C(=O)O |
Computed by PubChem (NCBI)