CAS 544480-62-8 appears in our catalog under these names: Boc-D-Cys(Me)-OH, ≥98%, ≥98%, N-(tert-Butoxycarbonyl)-S-methyl-D-cysteine, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-methylsulfanylpropanoic acid (CAS 544480-62-8) is a chemical compound with the molecular formula C9H17NO4S and a molecular weight of 235.30 g/mol. IUPAC name: (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-methylsulfanylpropanoic acid. InChIKey: WFDQTEFRLDDJAM-ZCFIWIBFSA-N.
| Molecular formula | C9H17NO4S |
|---|---|
| Molecular weight | 235.30 g/mol |
| IUPAC name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-methylsulfanylpropanoic acid |
| InChIKey | WFDQTEFRLDDJAM-ZCFIWIBFSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CSC)C(=O)O |
Computed by PubChem (NCBI)