cas: 110544-97-3 — see every product listed under this CAS number, including other names
Boc-D-Aad-OH 97% (CAS 110544-97-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A432711-100mg |
| cas | 110544-97-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 175.69 Pln | |
| Ambeed | 250mg | 225.75 Pln | |
| Ambeed | 1g | 542.81 Pln | |
| Ambeed | 5g | 1972.38 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A432711 |
(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanedioic acid (CAS 110544-97-3) is a chemical compound with the molecular formula C11H19NO6 and a molecular weight of 261.27 g/mol. IUPAC name: (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanedioic acid. InChIKey: QDTDLMJRZPSKDM-SSDOTTSWSA-N.
| Molecular formula | C11H19NO6 |
|---|---|
| Molecular weight | 261.27 g/mol |
| IUPAC name | (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanedioic acid |
| InChIKey | QDTDLMJRZPSKDM-SSDOTTSWSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CCCC(=O)O)C(=O)O |
Computed by PubChem (NCBI)