cas: 110544-97-3 — see every product listed under this CAS number, including other names
Boc-D-a-aminoadipic acid, 97% (CAS 110544-97-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F492733-1G |
| cas | 110544-97-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 862.21 Pln | |
| Fluorochem | 5g | 2892.75 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanedioic acid (CAS 110544-97-3) is a chemical compound with the molecular formula C11H19NO6 and a molecular weight of 261.27 g/mol. IUPAC name: (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanedioic acid. InChIKey: QDTDLMJRZPSKDM-SSDOTTSWSA-N.
| Molecular formula | C11H19NO6 |
|---|---|
| Molecular weight | 261.27 g/mol |
| IUPAC name | (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanedioic acid |
| InChIKey | QDTDLMJRZPSKDM-SSDOTTSWSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CCCC(=O)O)C(=O)O |
Computed by PubChem (NCBI)