cas: 51186-58-4 — see every product listed under this CAS number, including other names
Boc-D-Asp(OBzl)-OH 97% (CAS 51186-58-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 1000g, 250mg, 1g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A151838-5g |
| cas | 51186-58-4 |
| size | 5g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 220.19 Pln | |
| Ambeed | 1000g | 3107.12 Pln | |
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 197.94 Pln | |
| Ambeed | 10g | 253.56 Pln | |
| Ambeed | 25g | 292.50 Pln | |
| Ambeed | 100g | 670.75 Pln | |
| Ambeed | 500g | 1966.81 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A151838 |
(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxo-4-phenylmethoxybutanoic acid (CAS 51186-58-4) is a chemical compound with the molecular formula C16H21NO6 and a molecular weight of 323.34 g/mol. IUPAC name: (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxo-4-phenylmethoxybutanoic acid. InChIKey: SOHLZANWVLCPHK-GFCCVEGCSA-N.
| Molecular formula | C16H21NO6 |
|---|---|
| Molecular weight | 323.34 g/mol |
| IUPAC name | (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxo-4-phenylmethoxybutanoic acid |
| InChIKey | SOHLZANWVLCPHK-GFCCVEGCSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC(=O)OCC1=CC=CC=C1)C(=O)O |
Computed by PubChem (NCBI)