CAS 23291-96-5 appears in our catalog under these names: Dehydro Monocrotaline, Dehydro Monocrotaline, 90%, Dehydromonocrotaline. Offered by: Chemat Brand, TRC, MedChemExpress. Available pack sizes: on request, 50mg, 1 mg, 10 mg, 5 mg.
(1R,4R,5R,6R)-5,6-dihydroxy-4,5,6-trimethyl-2,8-dioxa-13-azatricyclo[8.5.1.013,16]hexadeca-10(16),11-diene-3,7-dione (CAS 23291-96-5) is a chemical compound with the molecular formula C16H21NO6 and a molecular weight of 323.34 g/mol. IUPAC name: (1R,4R,5R,6R)-5,6-dihydroxy-4,5,6-trimethyl-2,8-dioxa-13-azatricyclo[8.5.1.013,16]hexadeca-10(16),11-diene-3,7-dione. InChIKey: ZONSVLURFASOJK-LLAGZRPASA-N.
| Molecular formula | C16H21NO6 |
|---|---|
| Molecular weight | 323.34 g/mol |
| IUPAC name | (1R,4R,5R,6R)-5,6-dihydroxy-4,5,6-trimethyl-2,8-dioxa-13-azatricyclo[8.5.1.013,16]hexadeca-10(16),11-diene-3,7-dione |
| InChIKey | ZONSVLURFASOJK-LLAGZRPASA-N |
| SMILES | C[C@H]1C(=O)O[C@@H]2CCN3C2=C(COC(=O)[C@]([C@]1(C)O)(C)O)C=C3 |
Computed by PubChem (NCBI)