CAS 59587-94-9 appears in our catalog under these names: Boc-Glu-phenyl ester, Boc–Glu–phenyl ester, (S)-4-((tert-Butoxycarbonyl)amino)-5-oxo-5-phenoxypentanoic acid 97%. Offered by: Creative Peptides, GLPBio, Biosynth, Ambeed. Available pack sizes: 1g, 5g, 10g, 25g, 100mg, 250mg.
(4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-5-phenoxypentanoic acid (CAS 59587-94-9) is a chemical compound with the molecular formula C16H21NO6 and a molecular weight of 323.34 g/mol. IUPAC name: (4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-5-phenoxypentanoic acid. InChIKey: UUGORLVQLJSWBX-LBPRGKRZSA-N.
| Molecular formula | C16H21NO6 |
|---|---|
| Molecular weight | 323.34 g/mol |
| IUPAC name | (4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-5-phenoxypentanoic acid |
| InChIKey | UUGORLVQLJSWBX-LBPRGKRZSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCC(=O)O)C(=O)OC1=CC=CC=C1 |
Computed by PubChem (NCBI)