cas: 76379-01-6 — see every product listed under this CAS number, including other names
Boc-D-Glu(OMe)-OH 97% (CAS 76379-01-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1141631-1g |
| cas | 76379-01-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 181.25 Pln | |
| Ambeed | 25g | 342.56 Pln | |
| Ambeed | 100g | 882.12 Pln | |
| Ambeed | 500g | 3218.38 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A1141631 |
(2R)-5-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoic acid (CAS 76379-01-6) is a chemical compound with the molecular formula C11H19NO6 and a molecular weight of 261.27 g/mol. IUPAC name: (2R)-5-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoic acid. InChIKey: OHYMUFVCRVPMEY-SSDOTTSWSA-N.
| Molecular formula | C11H19NO6 |
|---|---|
| Molecular weight | 261.27 g/mol |
| IUPAC name | (2R)-5-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoic acid |
| InChIKey | OHYMUFVCRVPMEY-SSDOTTSWSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CCC(=O)OC)C(=O)O |
Computed by PubChem (NCBI)