cas: 76379-01-6 — see every product listed under this CAS number, including other names
(R)-2-((tert-Butoxycarbonyl)amino)-5-methoxy-5-oxopentanoic acid, 95% (CAS 76379-01-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F607963-1G |
| cas | 76379-01-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 91.65 Pln | |
| Fluorochem | 25g | 247.85 Pln | |
| Fluorochem | 100g | 653.95 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
(2R)-5-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoic acid (CAS 76379-01-6) is a chemical compound with the molecular formula C11H19NO6 and a molecular weight of 261.27 g/mol. IUPAC name: (2R)-5-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoic acid. InChIKey: OHYMUFVCRVPMEY-SSDOTTSWSA-N.
| Molecular formula | C11H19NO6 |
|---|---|
| Molecular weight | 261.27 g/mol |
| IUPAC name | (2R)-5-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoic acid |
| InChIKey | OHYMUFVCRVPMEY-SSDOTTSWSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CCC(=O)OC)C(=O)O |
Computed by PubChem (NCBI)