cas: 104719-63-3 — see every product listed under this CAS number, including other names
Boc-D-Glu(OtBu)-OH, 97%, 97% (CAS 104719-63-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119R9Z-250mg |
| cas | 104719-63-3 |
| size | 250mg |
| availability | 2000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 78.80 Pln | |
| Chemat | 10g | 98.00 Pln | |
| Chemat | 25g | 150.80 Pln | |
| Chemat | 100g | 410.00 Pln | |
| Chemat | 500g | 1344.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(2R)-5-[(2-methylpropan-2-yl)oxy]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoic acid (CAS 104719-63-3) is a chemical compound with the molecular formula C14H25NO6 and a molecular weight of 303.35 g/mol. IUPAC name: (2R)-5-[(2-methylpropan-2-yl)oxy]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoic acid. InChIKey: YGSRAYJBEREVRB-SECBINFHSA-N.
| Molecular formula | C14H25NO6 |
|---|---|
| Molecular weight | 303.35 g/mol |
| IUPAC name | (2R)-5-[(2-methylpropan-2-yl)oxy]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoic acid |
| InChIKey | YGSRAYJBEREVRB-SECBINFHSA-N |
| SMILES | CC(C)(C)OC(=O)CC[C@H](C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)