CAS 77004-76-3 is the registry number for 1-tert-butyl 4-methyl (2R)-2-{[(tert-butoxy)carbonyl]amino}butanedioate, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
1-O-tert-butyl 4-O-methyl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanedioate (CAS 77004-76-3) is a chemical compound with the molecular formula C14H25NO6 and a molecular weight of 303.35 g/mol. IUPAC name: 1-O-tert-butyl 4-O-methyl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanedioate. InChIKey: VQBQQLCEXJJCSY-SECBINFHSA-N.
| Molecular formula | C14H25NO6 |
|---|---|
| Molecular weight | 303.35 g/mol |
| IUPAC name | 1-O-tert-butyl 4-O-methyl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanedioate |
| InChIKey | VQBQQLCEXJJCSY-SECBINFHSA-N |
| SMILES | CC(C)(C)OC(=O)[C@@H](CC(=O)OC)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)