CAS 18635-49-9 appears in our catalog under these names: 4-tert-butyl 1-methyl (2S)-2-{[(tert-butoxy)carbonyl]amino}butanedioate, 98%, (S)-4-tert-Butyl 1-methyl 2-((tert-butoxycarbonyl)amino)succinate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
4-O-tert-butyl 1-O-methyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanedioate (CAS 18635-49-9) is a chemical compound with the molecular formula C14H25NO6 and a molecular weight of 303.35 g/mol. IUPAC name: 4-O-tert-butyl 1-O-methyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanedioate. InChIKey: PUDMHIVYJNZIHQ-VIFPVBQESA-N.
| Molecular formula | C14H25NO6 |
|---|---|
| Molecular weight | 303.35 g/mol |
| IUPAC name | 4-O-tert-butyl 1-O-methyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanedioate |
| InChIKey | PUDMHIVYJNZIHQ-VIFPVBQESA-N |
| SMILES | CC(C)(C)OC(=O)C[C@@H](C(=O)OC)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)