CAS 104719-63-3 appears in our catalog under these names: Boc–D–Glu(OtBu)–OH, N-Boc-D-glutamic acid 5-tert-butyl ester, 98% , Boc-D-glutamic acid-gamma-tert-butyl ester, Boc-D-Glu(OtBu)-OH 97%, Boc-D-Glu(OtBu)-OH, 97%, 97%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), Biosynth, Ambeed, Chemat. Available pack sizes: 25g, 5g, 50g, 10g, 100g, 250mg, 1g, 500g.
(2R)-5-[(2-methylpropan-2-yl)oxy]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoic acid (CAS 104719-63-3) is a chemical compound with the molecular formula C14H25NO6 and a molecular weight of 303.35 g/mol. IUPAC name: (2R)-5-[(2-methylpropan-2-yl)oxy]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoic acid. InChIKey: YGSRAYJBEREVRB-SECBINFHSA-N.
| Molecular formula | C14H25NO6 |
|---|---|
| Molecular weight | 303.35 g/mol |
| IUPAC name | (2R)-5-[(2-methylpropan-2-yl)oxy]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoic acid |
| InChIKey | YGSRAYJBEREVRB-SECBINFHSA-N |
| SMILES | CC(C)(C)OC(=O)CC[C@H](C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)