cas: 67198-86-1 — see every product listed under this CAS number, including other names
Boc-D-Homoserine Lactone, 98%, 98% (CAS 67198-86-1) is a chemical reagent available from Chemat. Available pack sizes: 50g, 100g, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11FCC2-50g |
| cas | 67198-86-1 |
| size | 50g |
| availability | 199.98g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50g | 990.80 Pln | |
| Chemat | 100g | 1782.80 Pln | |
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 88.40 Pln | |
| Chemat | 5g | 179.60 Pln | |
| Chemat | 25g | 544.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-[(3R)-2-oxooxolan-3-yl]carbamate (CAS 67198-86-1) is a chemical compound with the molecular formula C9H15NO4 and a molecular weight of 201.22 g/mol. IUPAC name: tert-butyl N-[(3R)-2-oxooxolan-3-yl]carbamate. InChIKey: IMWMFJMYEKHYKG-ZCFIWIBFSA-N.
| Molecular formula | C9H15NO4 |
|---|---|
| Molecular weight | 201.22 g/mol |
| IUPAC name | tert-butyl N-[(3R)-2-oxooxolan-3-yl]carbamate |
| InChIKey | IMWMFJMYEKHYKG-ZCFIWIBFSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CCOC1=O |
Computed by PubChem (NCBI)