cas: 127559-33-5 — see every product listed under this CAS number, including other names
Boc-D-Serinol(Bzl), 98% (CAS 127559-33-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F552518-1G |
| cas | 127559-33-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 351.98 Pln | |
| Fluorochem | 5g | 1205.84 Pln | |
| Fluorochem | 10g | 2231.52 Pln | |
| Fluorochem | 25g | 4418.25 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl N-[(2R)-1-hydroxy-3-phenylmethoxypropan-2-yl]carbamate (CAS 127559-33-5) is a chemical compound with the molecular formula C15H23NO4 and a molecular weight of 281.35 g/mol. IUPAC name: tert-butyl N-[(2R)-1-hydroxy-3-phenylmethoxypropan-2-yl]carbamate. InChIKey: MSIDLARYVJJEQY-CYBMUJFWSA-N.
| Molecular formula | C15H23NO4 |
|---|---|
| Molecular weight | 281.35 g/mol |
| IUPAC name | tert-butyl N-[(2R)-1-hydroxy-3-phenylmethoxypropan-2-yl]carbamate |
| InChIKey | MSIDLARYVJJEQY-CYBMUJFWSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CO)COCC1=CC=CC=C1 |
Computed by PubChem (NCBI)