cas: 25691-37-6 — see every product listed under this CAS number, including other names
Boc-Dab-OH 95% (CAS 25691-37-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A112589-250mg |
| cas | 25691-37-6 |
| size | 250mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 120.06 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 164.56 Pln | |
| Ambeed | 10g | 220.19 Pln | |
| Ambeed | 25g | 448.25 Pln | |
| Ambeed | 100g | 1571.88 Pln | |
| Ambeed | 500g | 7573.81 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A112589 |
(2S)-4-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (CAS 25691-37-6) is a chemical compound with the molecular formula C9H18N2O4 and a molecular weight of 218.25 g/mol. IUPAC name: (2S)-4-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid. InChIKey: MDCPCLPRWLKUIQ-LURJTMIESA-N.
| Molecular formula | C9H18N2O4 |
|---|---|
| Molecular weight | 218.25 g/mol |
| IUPAC name | (2S)-4-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| InChIKey | MDCPCLPRWLKUIQ-LURJTMIESA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCN)C(=O)O |
Computed by PubChem (NCBI)