CAS 30044-67-8 appears in our catalog under these names: Boc-Asparaginol, 95+%, Boc–Asn–ol, Boc-Asparaginol, 98%, 98%, Tert-butyl (S)-(4-amino-1-hydroxy-4-oxobutan-2-yl)carbamate, 98%. Offered by: AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 100g, 25g, 250mg.
Tert-butyl N-[(2S)-4-amino-1-hydroxy-4-oxobutan-2-yl]carbamate (CAS 30044-67-8) is a chemical compound with the molecular formula C9H18N2O4 and a molecular weight of 218.25 g/mol. IUPAC name: tert-butyl N-[(2S)-4-amino-1-hydroxy-4-oxobutan-2-yl]carbamate. InChIKey: BYCKHNZSBNGBQL-LURJTMIESA-N.
| Molecular formula | C9H18N2O4 |
|---|---|
| Molecular weight | 218.25 g/mol |
| IUPAC name | tert-butyl N-[(2S)-4-amino-1-hydroxy-4-oxobutan-2-yl]carbamate |
| InChIKey | BYCKHNZSBNGBQL-LURJTMIESA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC(=O)N)CO |
Computed by PubChem (NCBI)