Products 59014-27-6
CAS 59014-27-6 is the registry number for (8S,2R)-Diaminononanedioic acid. Offered by: Creative Peptides. Available pack sizes: on request.
(2S,8R)-2,8-diaminononanedioic acid (CAS 59014-27-6) is a chemical compound with the molecular formula C9H18N2O4 and a molecular weight of 218.25 g/mol. IUPAC name: (2S,8R)-2,8-diaminononanedioic acid. InChIKey: CZBYDJTWLGVCEV-KNVOCYPGSA-N.
| Molecular formula | C9H18N2O4 |
|---|---|
| Molecular weight | 218.25 g/mol |
| IUPAC name | (2S,8R)-2,8-diaminononanedioic acid |
| InChIKey | CZBYDJTWLGVCEV-KNVOCYPGSA-N |
| SMILES | C(CC[C@H](C(=O)O)N)CC[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)