Products 1374969-20-6

CAS 1374969-20-6 is the registry number for Cycloserine Related Compound 1. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Tert-butyl N-[(2R)-1-amino-3-methoxy-1-oxopropan-2-yl]carbamate (CAS 1374969-20-6) is a chemical compound with the molecular formula C9H18N2O4 and a molecular weight of 218.25 g/mol. IUPAC name: tert-butyl N-[(2R)-1-amino-3-methoxy-1-oxopropan-2-yl]carbamate. InChIKey: LNBYIYCVIDOMDM-ZCFIWIBFSA-N.

Identity
Molecular formulaC9H18N2O4
Molecular weight218.25 g/mol
IUPAC nametert-butyl N-[(2R)-1-amino-3-methoxy-1-oxopropan-2-yl]carbamate
InChIKeyLNBYIYCVIDOMDM-ZCFIWIBFSA-N
SMILESCC(C)(C)OC(=O)N[C@H](COC)C(=O)N

Computed by PubChem (NCBI)